C27H34ClN3O4 — CID 155011240
1-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole;octanedioic acid (PubChem CID 155011240) has the molecular formula C27H34ClN3O4 and a molecular weight of 500.04 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole;octanedioic acid.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole;octanedioic acid |
|---|---|
| PubChem CID | 155011240 |
| Molecular Formula | C27H34ClN3O4 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole;octanedioic acid |
| SMILES | Clc1ccc(Cn2c(CN3CCCC3)nc3ccccc32)cc1.O=C(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C19H20ClN3.C8H14O4/c20-16-9-7-15(8-10-16)13-23-18-6-2-1-5-17(18)21-19(23)14-22-11-3-4-12-22;9-7(10)5-3-1-2-4-6-8(11)12/h1-2,5-10H,3-4,11-14H2;1-6H2,(H,9,10)(H,11,12) |
| InChIKey | QBCOOSNTKLXQKT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|