C22H23ClF3N3O3S — CID 18467618
3-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide (PubChem CID 18467618) has the molecular formula C22H23ClF3N3O3S and a molecular weight of 501.96 g/mol. Its IUPAC name is 3-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide.
| Compound Name | 3-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18467618 |
| Molecular Formula | C22H23ClF3N3O3S |
| Molecular Weight | 501.96 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 3-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)c1ccc2nc(C)n(Cc3ccc(C(F)(F)F)cc3Cl)c2c1 |
| InChI | InChI=1S/C22H23ClF3N3O3S/c1-3-4-5-10-33(31,32)28-21(30)15-7-9-19-20(11-15)29(14(2)27-19)13-16-6-8-17(12-18(16)23)22(24,25)26/h6-9,11-12H,3-5,10,13H2,1-2H3,(H,28,30) |
| InChIKey | IXQKZLPLPADQIO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.96 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|