C23H30ClN5O4S — CID 22485077
3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methyl-N-(propylsulfamoyl)imidazo[4,5-b]pyridine-5-carboxamide (PubChem CID 22485077) has the molecular formula C23H30ClN5O4S and a molecular weight of 508.04 g/mol. Its IUPAC name is 3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methyl-N-(propylsulfamoyl)imidazo[4,5-b]pyridine-5-carboxamide.
| Compound Name | 3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methyl-N-(propylsulfamoyl)imidazo[4,5-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 22485077 |
| Molecular Formula | C23H30ClN5O4S |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methyl-N-(propylsulfamoyl)imidazo[4,5-b]pyridine-5-carboxamide |
| SMILES | CCCCCOc1ccc(Cn2c(C)nc3ccc(C(=O)NS(=O)(=O)NCCC)nc32)c(Cl)c1 |
| InChI | InChI=1S/C23H30ClN5O4S/c1-4-6-7-13-33-18-9-8-17(19(24)14-18)15-29-16(3)26-20-10-11-21(27-22(20)29)23(30)28-34(31,32)25-12-5-2/h8-11,14,25H,4-7,12-13,15H2,1-3H3,(H,28,30) |
| InChIKey | YEGLOTOVZJNPAS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|