C20H22Cl2N4O3S — CID 22388564
3-[(2,3-dichlorophenyl)methyl]-2-methyl-N-pentylsulfonylimidazo[4,5-b]pyridine-5-carboxamide (PubChem CID 22388564) has the molecular formula C20H22Cl2N4O3S and a molecular weight of 469.39 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)methyl]-2-methyl-N-pentylsulfonylimidazo[4,5-b]pyridine-5-carboxamide.
| Compound Name | 3-[(2,3-dichlorophenyl)methyl]-2-methyl-N-pentylsulfonylimidazo[4,5-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 22388564 |
| Molecular Formula | C20H22Cl2N4O3S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)methyl]-2-methyl-N-pentylsulfonylimidazo[4,5-b]pyridine-5-carboxamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)c1ccc2nc(C)n(Cc3cccc(Cl)c3Cl)c2n1 |
| InChI | InChI=1S/C20H22Cl2N4O3S/c1-3-4-5-11-30(28,29)25-20(27)17-10-9-16-19(24-17)26(13(2)23-16)12-14-7-6-8-15(21)18(14)22/h6-10H,3-5,11-12H2,1-2H3,(H,25,27) |
| InChIKey | XYCFFLLIGIAMTD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|