C19H21ClN4O2 — CID 22388233
3-[[4-(butylamino)-2-chlorophenyl]methyl]-2-methylimidazo[4,5-b]pyridine-5-carboxylic acid (PubChem CID 22388233) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 3-[[4-(butylamino)-2-chlorophenyl]methyl]-2-methylimidazo[4,5-b]pyridine-5-carboxylic acid.
| Compound Name | 3-[[4-(butylamino)-2-chlorophenyl]methyl]-2-methylimidazo[4,5-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 22388233 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 3-[[4-(butylamino)-2-chlorophenyl]methyl]-2-methylimidazo[4,5-b]pyridine-5-carboxylic acid |
| SMILES | CCCCNc1ccc(Cn2c(C)nc3ccc(C(=O)O)nc32)c(Cl)c1 |
| InChI | InChI=1S/C19H21ClN4O2/c1-3-4-9-21-14-6-5-13(15(20)10-14)11-24-12(2)22-16-7-8-17(19(25)26)23-18(16)24/h5-8,10,21H,3-4,9,11H2,1-2H3,(H,25,26) |
| InChIKey | LTARPQAGMUNLQF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|