C23H18ClN3O2 — CID 22387747
3-[[2-chloro-4-[(E)-2-phenylethenyl]phenyl]methyl]-2-methylimidazo[4,5-b]pyridine-5-carboxylic acid (PubChem CID 22387747) has the molecular formula C23H18ClN3O2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(E)-2-phenylethenyl]phenyl]methyl]-2-methylimidazo[4,5-b]pyridine-5-carboxylic acid.
| Compound Name | 3-[[2-chloro-4-[(E)-2-phenylethenyl]phenyl]methyl]-2-methylimidazo[4,5-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 22387747 |
| Molecular Formula | C23H18ClN3O2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-[[2-chloro-4-[(E)-2-phenylethenyl]phenyl]methyl]-2-methylimidazo[4,5-b]pyridine-5-carboxylic acid |
| SMILES | Cc1nc2ccc(C(=O)O)nc2n1Cc1ccc(/C=C/c2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H18ClN3O2/c1-15-25-20-11-12-21(23(28)29)26-22(20)27(15)14-18-10-9-17(13-19(18)24)8-7-16-5-3-2-4-6-16/h2-13H,14H2,1H3,(H,28,29)/b8-7+ |
| InChIKey | WYJNWJFQEZEXOC-BQYQJAHWSA-N |
| XLogP | 5.31 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|