C34H36ClN3O4S — CID 22058655
(E)-2-benzyl-3-[3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methylimidazol-4-yl]-N-[(E)-2-phenylethenyl]sulfonylprop-2-enamide (PubChem CID 22058655) has the molecular formula C34H36ClN3O4S and a molecular weight of 618.20 g/mol. Its IUPAC name is (E)-2-benzyl-3-[3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methylimidazol-4-yl]-N-[(E)-2-phenylethenyl]sulfonylprop-2-enamide.
| Compound Name | (E)-2-benzyl-3-[3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methylimidazol-4-yl]-N-[(E)-2-phenylethenyl]sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 22058655 |
| Molecular Formula | C34H36ClN3O4S |
| Molecular Weight | 618.20 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | (E)-2-benzyl-3-[3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methylimidazol-4-yl]-N-[(E)-2-phenylethenyl]sulfonylprop-2-enamide |
| SMILES | CCCCCOc1ccc(Cn2c(/C=C(\Cc3ccccc3)C(=O)NS(=O)(=O)/C=C/c3ccccc3)cnc2C)c(Cl)c1 |
| InChI | InChI=1S/C34H36ClN3O4S/c1-3-4-11-19-42-32-17-16-29(33(35)23-32)25-38-26(2)36-24-31(38)22-30(21-28-14-9-6-10-15-28)34(39)37-43(40,41)20-18-27-12-7-5-8-13-27/h5-10,12-18,20,22-24H,3-4,11,19,21,25H2,1-2H3,(H,37,39)/b20-18+,30-22+ |
| InChIKey | YCPWMPUPMIDDIV-IUXVHVDYSA-N |
| XLogP | 7.21 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.20 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|