C21H17Cl2N2O2- — CID 21198600
(E)-2-benzyl-3-[3-[(2,4-dichlorophenyl)methyl]-2-methylimidazol-4-yl]prop-2-enoate (PubChem CID 21198600) has the molecular formula C21H17Cl2N2O2- and a molecular weight of 400.29 g/mol. Its IUPAC name is (E)-2-benzyl-3-[3-[(2,4-dichlorophenyl)methyl]-2-methylimidazol-4-yl]prop-2-enoate.
| Compound Name | (E)-2-benzyl-3-[3-[(2,4-dichlorophenyl)methyl]-2-methylimidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 21198600 |
| Molecular Formula | C21H17Cl2N2O2- |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | (E)-2-benzyl-3-[3-[(2,4-dichlorophenyl)methyl]-2-methylimidazol-4-yl]prop-2-enoate |
| SMILES | Cc1ncc(/C=C(\Cc2ccccc2)C(=O)[O-])n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O2/c1-14-24-12-19(25(14)13-16-7-8-18(22)11-20(16)23)10-17(21(26)27)9-15-5-3-2-4-6-15/h2-8,10-12H,9,13H2,1H3,(H,26,27)/p-1/b17-10+ |
| InChIKey | HAFREERNPUBPSX-LICLKQGHSA-M |
| XLogP | 3.92 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|