C24H26ClN3O2 — CID 54475887
2-[(4-aminophenyl)methyl]-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]prop-2-enoic acid (PubChem CID 54475887) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl]-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]prop-2-enoic acid.
| Compound Name | 2-[(4-aminophenyl)methyl]-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54475887 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-[(4-aminophenyl)methyl]-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]prop-2-enoic acid |
| SMILES | CCCCc1ncc(C=C(Cc2ccc(N)cc2)C(=O)O)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H26ClN3O2/c1-2-3-8-23-27-15-21(28(23)16-18-6-4-5-7-22(18)25)14-19(24(29)30)13-17-9-11-20(26)12-10-17/h4-7,9-12,14-15H,2-3,8,13,16,26H2,1H3,(H,29,30) |
| InChIKey | XLNVCEDEMNNHQB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|