C27H31ClN2O5 — CID 15144936
(E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enoic acid (PubChem CID 15144936) has the molecular formula C27H31ClN2O5 and a molecular weight of 499.01 g/mol. Its IUPAC name is (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 15144936 |
| Molecular Formula | C27H31ClN2O5 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enoic acid |
| SMILES | CCCCc1ncc(/C=C(\Cc2cc(OC)c(OC)c(OC)c2)C(=O)O)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C27H31ClN2O5/c1-5-6-11-25-29-16-21(30(25)17-19-9-7-8-10-22(19)28)15-20(27(31)32)12-18-13-23(33-2)26(35-4)24(14-18)34-3/h7-10,13-16H,5-6,11-12,17H2,1-4H3,(H,31,32)/b20-15+ |
| InChIKey | PCWXTOPRDMTJPG-HMMYKYKNSA-N |
| XLogP | 5.66 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|