C25H27ClN2O2 — CID 10410027
(2E)-2-[[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]methylidene]-4-phenylbutanoic acid (PubChem CID 10410027) has the molecular formula C25H27ClN2O2 and a molecular weight of 422.96 g/mol. Its IUPAC name is (2E)-2-[[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]methylidene]-4-phenylbutanoic acid.
| Compound Name | (2E)-2-[[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]methylidene]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 10410027 |
| Molecular Formula | C25H27ClN2O2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (2E)-2-[[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]methylidene]-4-phenylbutanoic acid |
| SMILES | CCCCc1ncc(/C=C(\CCc2ccccc2)C(=O)O)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H27ClN2O2/c1-2-3-13-24-27-17-22(28(24)18-21-11-7-8-12-23(21)26)16-20(25(29)30)15-14-19-9-5-4-6-10-19/h4-12,16-17H,2-3,13-15,18H2,1H3,(H,29,30)/b20-16+ |
| InChIKey | SXZMGFRTEQNQIN-CAPFRKAQSA-N |
| XLogP | 6.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|