C24H26N2O3 — CID 54313391
2-benzyl-3-[2-butyl-3-[(2-hydroxyphenyl)methyl]imidazol-4-yl]prop-2-enoic acid (PubChem CID 54313391) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-benzyl-3-[2-butyl-3-[(2-hydroxyphenyl)methyl]imidazol-4-yl]prop-2-enoic acid.
| Compound Name | 2-benzyl-3-[2-butyl-3-[(2-hydroxyphenyl)methyl]imidazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54313391 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-benzyl-3-[2-butyl-3-[(2-hydroxyphenyl)methyl]imidazol-4-yl]prop-2-enoic acid |
| SMILES | CCCCc1ncc(C=C(Cc2ccccc2)C(=O)O)n1Cc1ccccc1O |
| InChI | InChI=1S/C24H26N2O3/c1-2-3-13-23-25-16-21(26(23)17-19-11-7-8-12-22(19)27)15-20(24(28)29)14-18-9-5-4-6-10-18/h4-12,15-16,27H,2-3,13-14,17H2,1H3,(H,28,29) |
| InChIKey | SMLOXJQTQWQKSM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|