C23H24N2O5S — CID 67887555
2-[[2-butyl-5-[(E)-2-carboxy-3-thiophen-2-ylprop-1-enyl]imidazol-1-yl]methyl]-6-hydroxybenzoic acid (PubChem CID 67887555) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 2-[[2-butyl-5-[(E)-2-carboxy-3-thiophen-2-ylprop-1-enyl]imidazol-1-yl]methyl]-6-hydroxybenzoic acid.
| Compound Name | 2-[[2-butyl-5-[(E)-2-carboxy-3-thiophen-2-ylprop-1-enyl]imidazol-1-yl]methyl]-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 67887555 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-[[2-butyl-5-[(E)-2-carboxy-3-thiophen-2-ylprop-1-enyl]imidazol-1-yl]methyl]-6-hydroxybenzoic acid |
| SMILES | CCCCc1ncc(/C=C(\Cc2cccs2)C(=O)O)n1Cc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C23H24N2O5S/c1-2-3-9-20-24-13-17(11-16(22(27)28)12-18-7-5-10-31-18)25(20)14-15-6-4-8-19(26)21(15)23(29)30/h4-8,10-11,13,26H,2-3,9,12,14H2,1H3,(H,27,28)(H,29,30)/b16-11+ |
| InChIKey | AORBXMOACVNTLX-LFIBNONCSA-N |
| XLogP | 4.45 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|