C25H30N2O4S — CID 143021647
4-[[5-[(E)-2-carboxy-4-thiophen-2-ylbut-1-enyl]-2-propylimidazol-1-yl]methyl]benzoic acid;ethane (PubChem CID 143021647) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is 4-[[5-[(E)-2-carboxy-4-thiophen-2-ylbut-1-enyl]-2-propylimidazol-1-yl]methyl]benzoic acid;ethane.
| Compound Name | 4-[[5-[(E)-2-carboxy-4-thiophen-2-ylbut-1-enyl]-2-propylimidazol-1-yl]methyl]benzoic acid;ethane |
|---|---|
| PubChem CID | 143021647 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 4-[[5-[(E)-2-carboxy-4-thiophen-2-ylbut-1-enyl]-2-propylimidazol-1-yl]methyl]benzoic acid;ethane |
| SMILES | CC.CCCc1ncc(/C=C(\CCc2cccs2)C(=O)O)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H24N2O4S.C2H6/c1-2-4-21-24-14-19(13-18(23(28)29)10-11-20-5-3-12-30-20)25(21)15-16-6-8-17(9-7-16)22(26)27;1-2/h3,5-9,12-14H,2,4,10-11,15H2,1H3,(H,26,27)(H,28,29);1-2H3/b18-13+; |
| InChIKey | FAOPRGZMIZFNFO-PUBYZPQMSA-N |
| XLogP | 5.77 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|