C23H28N4O4 — CID 67842204
4-[[5-[(E)-(3-butyl-1-methyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-propylimidazol-1-yl]methyl]benzoic acid (PubChem CID 67842204) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-[[5-[(E)-(3-butyl-1-methyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-propylimidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[5-[(E)-(3-butyl-1-methyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-propylimidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 67842204 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-[[5-[(E)-(3-butyl-1-methyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-propylimidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCN1C(=O)N(C)C(=O)/C1=C\c1cnc(CCC)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-4-6-12-26-19(21(28)25(3)23(26)31)13-18-14-24-20(7-5-2)27(18)15-16-8-10-17(11-9-16)22(29)30/h8-11,13-14H,4-7,12,15H2,1-3H3,(H,29,30)/b19-13+ |
| InChIKey | DRMHSGFFCWROBY-CPNJWEJPSA-N |
| XLogP | 3.62 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|