C29H40N4O4 — CID 10413944
methyl 4-[[2-butyl-5-[(Z)-(1-butyl-2,5-dioxo-3-pentylimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoate (PubChem CID 10413944) has the molecular formula C29H40N4O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is methyl 4-[[2-butyl-5-[(Z)-(1-butyl-2,5-dioxo-3-pentylimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[2-butyl-5-[(Z)-(1-butyl-2,5-dioxo-3-pentylimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 10413944 |
| Molecular Formula | C29H40N4O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | methyl 4-[[2-butyl-5-[(Z)-(1-butyl-2,5-dioxo-3-pentylimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoate |
| SMILES | CCCCCN1C(=O)N(CCCC)C(=O)/C1=C/c1cnc(CCCC)n1Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C29H40N4O4/c1-5-8-11-18-31-25(27(34)32(29(31)36)17-10-7-3)19-24-20-30-26(12-9-6-2)33(24)21-22-13-15-23(16-14-22)28(35)37-4/h13-16,19-20H,5-12,17-18,21H2,1-4H3/b25-19- |
| InChIKey | FXMUFCWXQFYTCY-PLRJNAJWSA-N |
| XLogP | 5.66 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|