C35H39ClN4O4 — CID 67806015
methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(naphthalen-2-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate;hydrochloride (PubChem CID 67806015) has the molecular formula C35H39ClN4O4 and a molecular weight of 615.17 g/mol. Its IUPAC name is methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(naphthalen-2-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate;hydrochloride.
| Compound Name | methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(naphthalen-2-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 67806015 |
| Molecular Formula | C35H39ClN4O4 |
| Molecular Weight | 615.17 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(naphthalen-2-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate;hydrochloride |
| SMILES | CCCCc1ncc(/C=C2/C(=O)N(CCCC)C(=O)N2Cc2ccc3ccccc3c2)n1Cc1ccc(C(=O)OC)cc1.Cl |
| InChI | InChI=1S/C35H38N4O4.ClH/c1-4-6-12-32-36-22-30(38(32)23-25-13-17-28(18-14-25)34(41)43-3)21-31-33(40)37(19-7-5-2)35(42)39(31)24-26-15-16-27-10-8-9-11-29(27)20-26;/h8-11,13-18,20-22H,4-7,12,19,23-24H2,1-3H3;1H/b31-21-; |
| InChIKey | ZADXBTROHQDHJB-ITAKFYBTSA-N |
| XLogP | 7.24 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.17 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|