C24H29ClN4O4 — CID 67787053
methyl 4-[[2-butyl-5-[(3-butyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]-3-chlorobenzoate (PubChem CID 67787053) has the molecular formula C24H29ClN4O4 and a molecular weight of 472.97 g/mol. Its IUPAC name is methyl 4-[[2-butyl-5-[(3-butyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]-3-chlorobenzoate.
| Compound Name | methyl 4-[[2-butyl-5-[(3-butyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]-3-chlorobenzoate |
|---|---|
| PubChem CID | 67787053 |
| Molecular Formula | C24H29ClN4O4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | methyl 4-[[2-butyl-5-[(3-butyl-2,5-dioxoimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]-3-chlorobenzoate |
| SMILES | CCCCc1ncc(C=C2C(=O)NC(=O)N2CCCC)n1Cc1ccc(C(=O)OC)cc1Cl |
| InChI | InChI=1S/C24H29ClN4O4/c1-4-6-8-21-26-14-18(13-20-22(30)27-24(32)28(20)11-7-5-2)29(21)15-17-10-9-16(12-19(17)25)23(31)33-3/h9-10,12-14H,4-8,11,15H2,1-3H3,(H,27,30,32) |
| InChIKey | NBUJWNMHBIUHOA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|