C17H19ClN2O3 — CID 19919877
methyl 4-[(2-butyl-5-formylimidazol-1-yl)methyl]-3-chlorobenzoate (PubChem CID 19919877) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is methyl 4-[(2-butyl-5-formylimidazol-1-yl)methyl]-3-chlorobenzoate.
| Compound Name | methyl 4-[(2-butyl-5-formylimidazol-1-yl)methyl]-3-chlorobenzoate |
|---|---|
| PubChem CID | 19919877 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | methyl 4-[(2-butyl-5-formylimidazol-1-yl)methyl]-3-chlorobenzoate |
| SMILES | CCCCc1ncc(C=O)n1Cc1ccc(C(=O)OC)cc1Cl |
| InChI | InChI=1S/C17H19ClN2O3/c1-3-4-5-16-19-9-14(11-21)20(16)10-13-7-6-12(8-15(13)18)17(22)23-2/h6-9,11H,3-5,10H2,1-2H3 |
| InChIKey | NDPDNAZFNIWGGD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|