C21H21ClN2O2 — CID 23191507
[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl] benzoate (PubChem CID 23191507) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is [2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl] benzoate.
| Compound Name | [2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl] benzoate |
|---|---|
| PubChem CID | 23191507 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl] benzoate |
| SMILES | CCCCc1ncc(OC(=O)c2ccccc2)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C21H21ClN2O2/c1-2-3-13-19-23-14-20(26-21(25)16-9-5-4-6-10-16)24(19)15-17-11-7-8-12-18(17)22/h4-12,14H,2-3,13,15H2,1H3 |
| InChIKey | CBNVBAOUQWEACL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |