C23H24ClN3O2 — CID 86746549
(E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-pyridin-4-ylbut-2-enoic acid (PubChem CID 86746549) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-pyridin-4-ylbut-2-enoic acid.
| Compound Name | (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-pyridin-4-ylbut-2-enoic acid |
|---|---|
| PubChem CID | 86746549 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-pyridin-4-ylbut-2-enoic acid |
| SMILES | CCCCc1ncc(/C(C)=C(/C(=O)O)c2ccncc2)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C23H24ClN3O2/c1-3-4-9-21-26-14-20(27(21)15-18-7-5-6-8-19(18)24)16(2)22(23(28)29)17-10-12-25-13-11-17/h5-8,10-14H,3-4,9,15H2,1-2H3,(H,28,29)/b22-16+ |
| InChIKey | LAPDPFPGXMQXCB-CJLVFECKSA-N |
| XLogP | 5.34 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|