C23H25ClN2O2S — CID 142629939
(E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)but-2-enoic acid (PubChem CID 142629939) has the molecular formula C23H25ClN2O2S and a molecular weight of 428.99 g/mol. Its IUPAC name is (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)but-2-enoic acid.
| Compound Name | (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)but-2-enoic acid |
|---|---|
| PubChem CID | 142629939 |
| Molecular Formula | C23H25ClN2O2S |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)but-2-enoic acid |
| SMILES | CCCCc1ncc(/C(C)=C(\Cc2cccs2)C(=O)O)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C23H25ClN2O2S/c1-3-4-11-22-25-14-21(26(22)15-17-8-5-6-10-20(17)24)16(2)19(23(27)28)13-18-9-7-12-29-18/h5-10,12,14H,3-4,11,13,15H2,1-2H3,(H,27,28)/b19-16+ |
| InChIKey | BGKQVTUDQKEQCD-KNTRCKAVSA-N |
| XLogP | 6.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|