C20H25ClN2O2 — CID 67736161
(E)-6-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]hex-4-enoic acid (PubChem CID 67736161) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is (E)-6-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]hex-4-enoic acid.
| Compound Name | (E)-6-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 67736161 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (E)-6-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]hex-4-enoic acid |
| SMILES | CCCCc1ncc(C/C=C/CCC(=O)O)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C20H25ClN2O2/c1-2-3-12-19-22-14-17(10-5-4-6-13-20(24)25)23(19)15-16-9-7-8-11-18(16)21/h4-5,7-9,11,14H,2-3,6,10,12-13,15H2,1H3,(H,24,25)/b5-4+ |
| InChIKey | LCPDNEVHIIZVPC-SNAWJCMRSA-N |
| XLogP | 4.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|