C19H23ClN2O2 — CID 10337714
methyl (E)-4-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]but-3-enoate (PubChem CID 10337714) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is methyl (E)-4-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]but-3-enoate.
| Compound Name | methyl (E)-4-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]but-3-enoate |
|---|---|
| PubChem CID | 10337714 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | methyl (E)-4-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]but-3-enoate |
| SMILES | CCCCc1ncc(/C=C/CC(=O)OC)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C19H23ClN2O2/c1-3-4-11-18-21-13-16(9-7-12-19(23)24-2)22(18)14-15-8-5-6-10-17(15)20/h5-10,13H,3-4,11-12,14H2,1-2H3/b9-7+ |
| InChIKey | YZSUOGWBLJNNFM-VQHVLOKHSA-N |
| XLogP | 4.50 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |