C23H25ClN2O3 — CID 10341627
methyl (Z)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-(furan-2-ylmethyl)prop-2-enoate (PubChem CID 10341627) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is methyl (Z)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-(furan-2-ylmethyl)prop-2-enoate.
| Compound Name | methyl (Z)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-(furan-2-ylmethyl)prop-2-enoate |
|---|---|
| PubChem CID | 10341627 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | methyl (Z)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-(furan-2-ylmethyl)prop-2-enoate |
| SMILES | CCCCc1ncc(/C=C(/Cc2ccco2)C(=O)OC)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C23H25ClN2O3/c1-3-4-11-22-25-15-19(26(22)16-17-8-5-6-10-21(17)24)13-18(23(27)28-2)14-20-9-7-12-29-20/h5-10,12-13,15H,3-4,11,14,16H2,1-2H3/b18-13- |
| InChIKey | BFUPTWCYUXSBJL-AQTBWJFISA-N |
| XLogP | 5.32 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|