C24H28N2O3S — CID 54360833
methyl 3-[2-butyl-3-[(2-methoxyphenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoate (PubChem CID 54360833) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is methyl 3-[2-butyl-3-[(2-methoxyphenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoate.
| Compound Name | methyl 3-[2-butyl-3-[(2-methoxyphenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoate |
|---|---|
| PubChem CID | 54360833 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | methyl 3-[2-butyl-3-[(2-methoxyphenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoate |
| SMILES | CCCCc1ncc(C=C(Cc2cccs2)C(=O)OC)n1Cc1ccccc1OC |
| InChI | InChI=1S/C24H28N2O3S/c1-4-5-12-23-25-16-20(26(23)17-18-9-6-7-11-22(18)28-2)14-19(24(27)29-3)15-21-10-8-13-30-21/h6-11,13-14,16H,4-5,12,15,17H2,1-3H3 |
| InChIKey | UMJDOAISFXNWIK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|