C22H24N6OS — CID 54396273
2-[[2-butyl-5-[2-(2H-tetrazol-5-yl)-3-thiophen-2-ylprop-1-enyl]imidazol-1-yl]methyl]phenol (PubChem CID 54396273) has the molecular formula C22H24N6OS and a molecular weight of 420.54 g/mol. Its IUPAC name is 2-[[2-butyl-5-[2-(2H-tetrazol-5-yl)-3-thiophen-2-ylprop-1-enyl]imidazol-1-yl]methyl]phenol.
| Compound Name | 2-[[2-butyl-5-[2-(2H-tetrazol-5-yl)-3-thiophen-2-ylprop-1-enyl]imidazol-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 54396273 |
| Molecular Formula | C22H24N6OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-[[2-butyl-5-[2-(2H-tetrazol-5-yl)-3-thiophen-2-ylprop-1-enyl]imidazol-1-yl]methyl]phenol |
| SMILES | CCCCc1ncc(C=C(Cc2cccs2)c2nn[nH]n2)n1Cc1ccccc1O |
| InChI | InChI=1S/C22H24N6OS/c1-2-3-10-21-23-14-18(28(21)15-16-7-4-5-9-20(16)29)12-17(22-24-26-27-25-22)13-19-8-6-11-30-19/h4-9,11-12,14,29H,2-3,10,13,15H2,1H3,(H,24,25,26,27) |
| InChIKey | VKEQGALJQXXUED-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|