C22H23N7O2S — CID 67833616
5-[(E)-1-[2-butyl-3-[(2-nitrophenyl)methyl]imidazol-4-yl]-3-thiophen-3-ylprop-1-en-2-yl]-2H-tetrazole (PubChem CID 67833616) has the molecular formula C22H23N7O2S and a molecular weight of 449.54 g/mol. Its IUPAC name is 5-[(E)-1-[2-butyl-3-[(2-nitrophenyl)methyl]imidazol-4-yl]-3-thiophen-3-ylprop-1-en-2-yl]-2H-tetrazole.
| Compound Name | 5-[(E)-1-[2-butyl-3-[(2-nitrophenyl)methyl]imidazol-4-yl]-3-thiophen-3-ylprop-1-en-2-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 67833616 |
| Molecular Formula | C22H23N7O2S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 5-[(E)-1-[2-butyl-3-[(2-nitrophenyl)methyl]imidazol-4-yl]-3-thiophen-3-ylprop-1-en-2-yl]-2H-tetrazole |
| SMILES | CCCCc1ncc(/C=C(\Cc2ccsc2)c2nn[nH]n2)n1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23N7O2S/c1-2-3-8-21-23-13-19(28(21)14-17-6-4-5-7-20(17)29(30)31)12-18(22-24-26-27-25-22)11-16-9-10-32-15-16/h4-7,9-10,12-13,15H,2-3,8,11,14H2,1H3,(H,24,25,26,27)/b18-12+ |
| InChIKey | HKKBHDYYCHPQNB-LDADJPATSA-N |
| XLogP | 4.54 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|