C27H31ClN2O4 — CID 10254698
methyl (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(3,4-dimethoxyphenyl)methyl]prop-2-enoate (PubChem CID 10254698) has the molecular formula C27H31ClN2O4 and a molecular weight of 483.01 g/mol. Its IUPAC name is methyl (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(3,4-dimethoxyphenyl)methyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(3,4-dimethoxyphenyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 10254698 |
| Molecular Formula | C27H31ClN2O4 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | methyl (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(3,4-dimethoxyphenyl)methyl]prop-2-enoate |
| SMILES | CCCCc1ncc(/C=C(\Cc2ccc(OC)c(OC)c2)C(=O)OC)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C27H31ClN2O4/c1-5-6-11-26-29-17-22(30(26)18-20-9-7-8-10-23(20)28)16-21(27(31)34-4)14-19-12-13-24(32-2)25(15-19)33-3/h7-10,12-13,15-17H,5-6,11,14,18H2,1-4H3/b21-16+ |
| InChIKey | WTGPVGYENJOIKF-LTGZKZEYSA-N |
| XLogP | 5.74 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|