C24H24ClN3O4 — CID 15144940
(E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(4-nitrophenyl)methyl]prop-2-enoic acid (PubChem CID 15144940) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(4-nitrophenyl)methyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(4-nitrophenyl)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 15144940 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (E)-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]-2-[(4-nitrophenyl)methyl]prop-2-enoic acid |
| SMILES | CCCCc1ncc(/C=C(\Cc2ccc([N+](=O)[O-])cc2)C(=O)O)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H24ClN3O4/c1-2-3-8-23-26-15-21(27(23)16-18-6-4-5-7-22(18)25)14-19(24(29)30)13-17-9-11-20(12-10-17)28(31)32/h4-7,9-12,14-15H,2-3,8,13,16H2,1H3,(H,29,30)/b19-14+ |
| InChIKey | RVIZMQOKPPHJHF-XMHGGMMESA-N |
| XLogP | 5.55 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|