C24H24N2O4 — CID 54018913
4-[[5-(2-carboxy-3-phenylprop-1-enyl)-2-propylimidazol-1-yl]methyl]benzoic acid (PubChem CID 54018913) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[[5-(2-carboxy-3-phenylprop-1-enyl)-2-propylimidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[5-(2-carboxy-3-phenylprop-1-enyl)-2-propylimidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 54018913 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4-[[5-(2-carboxy-3-phenylprop-1-enyl)-2-propylimidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCc1ncc(C=C(Cc2ccccc2)C(=O)O)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-2-6-22-25-15-21(14-20(24(29)30)13-17-7-4-3-5-8-17)26(22)16-18-9-11-19(12-10-18)23(27)28/h3-5,7-12,14-15H,2,6,13,16H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | KXNYDTKEVJQCKV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|