C29H29N3O3 — CID 67849408
4-[[5-[(E)-3-amino-2-benzyl-3-oxoprop-1-enyl]-2-butylimidazol-1-yl]methyl]naphthalene-2-carboxylic acid (PubChem CID 67849408) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[[5-[(E)-3-amino-2-benzyl-3-oxoprop-1-enyl]-2-butylimidazol-1-yl]methyl]naphthalene-2-carboxylic acid.
| Compound Name | 4-[[5-[(E)-3-amino-2-benzyl-3-oxoprop-1-enyl]-2-butylimidazol-1-yl]methyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 67849408 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 4-[[5-[(E)-3-amino-2-benzyl-3-oxoprop-1-enyl]-2-butylimidazol-1-yl]methyl]naphthalene-2-carboxylic acid |
| SMILES | CCCCc1ncc(/C=C(\Cc2ccccc2)C(N)=O)n1Cc1cc(C(=O)O)cc2ccccc12 |
| InChI | InChI=1S/C29H29N3O3/c1-2-3-13-27-31-18-25(17-22(28(30)33)14-20-9-5-4-6-10-20)32(27)19-24-16-23(29(34)35)15-21-11-7-8-12-26(21)24/h4-12,15-18H,2-3,13-14,19H2,1H3,(H2,30,33)(H,34,35)/b22-17+ |
| InChIKey | KTMYTFLEELHIDV-OQKWZONESA-N |
| XLogP | 5.24 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|