C24H26N2O5S — CID 76688383
4-[[2-butyl-5-[2-carboxy-3-(5-methoxythiophen-2-yl)prop-1-enyl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 76688383) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is 4-[[2-butyl-5-[2-carboxy-3-(5-methoxythiophen-2-yl)prop-1-enyl]imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-butyl-5-[2-carboxy-3-(5-methoxythiophen-2-yl)prop-1-enyl]imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 76688383 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 4-[[2-butyl-5-[2-carboxy-3-(5-methoxythiophen-2-yl)prop-1-enyl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCc1ncc(C=C(Cc2ccc(OC)s2)C(=O)O)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H26N2O5S/c1-3-4-5-21-25-14-19(26(21)15-16-6-8-17(9-7-16)23(27)28)12-18(24(29)30)13-20-10-11-22(31-2)32-20/h6-12,14H,3-5,13,15H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | OWLPSQKIOXRMLQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|