C23H26N2O3S — CID 54150493
3-[2-butyl-3-[(2-methoxyphenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoic acid (PubChem CID 54150493) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-[2-butyl-3-[(2-methoxyphenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoic acid.
| Compound Name | 3-[2-butyl-3-[(2-methoxyphenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54150493 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-[2-butyl-3-[(2-methoxyphenyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoic acid |
| SMILES | CCCCc1ncc(C=C(Cc2cccs2)C(=O)O)n1Cc1ccccc1OC |
| InChI | InChI=1S/C23H26N2O3S/c1-3-4-11-22-24-15-19(13-18(23(26)27)14-20-9-7-12-29-20)25(22)16-17-8-5-6-10-21(17)28-2/h5-10,12-13,15H,3-4,11,14,16H2,1-2H3,(H,26,27) |
| InChIKey | OHJRBSMXVYEVDG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|