C25H24N4O4 — CID 54024862
4-[[2-butyl-5-[(2,5-dioxo-3-phenylimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 54024862) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-[[2-butyl-5-[(2,5-dioxo-3-phenylimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-butyl-5-[(2,5-dioxo-3-phenylimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 54024862 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 4-[[2-butyl-5-[(2,5-dioxo-3-phenylimidazolidin-4-ylidene)methyl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCc1ncc(C=C2C(=O)NC(=O)N2c2ccccc2)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H24N4O4/c1-2-3-9-22-26-15-20(28(22)16-17-10-12-18(13-11-17)24(31)32)14-21-23(30)27-25(33)29(21)19-7-5-4-6-8-19/h4-8,10-15H,2-3,9,16H2,1H3,(H,31,32)(H,27,30,33) |
| InChIKey | LBLWHQQMQDDNHG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|