C28H38N2O2S — CID 19936747
methyl (E)-3-[3-[2-(1-adamantyl)ethyl]-2-butylimidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoate (PubChem CID 19936747) has the molecular formula C28H38N2O2S and a molecular weight of 466.69 g/mol. Its IUPAC name is methyl (E)-3-[3-[2-(1-adamantyl)ethyl]-2-butylimidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[2-(1-adamantyl)ethyl]-2-butylimidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoate |
|---|---|
| PubChem CID | 19936747 |
| Molecular Formula | C28H38N2O2S |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | methyl (E)-3-[3-[2-(1-adamantyl)ethyl]-2-butylimidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoate |
| SMILES | CCCCc1ncc(/C=C(\Cc2cccs2)C(=O)OC)n1CCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H38N2O2S/c1-3-4-7-26-29-19-24(14-23(27(31)32-2)15-25-6-5-10-33-25)30(26)9-8-28-16-20-11-21(17-28)13-22(12-20)18-28/h5-6,10,14,19-22H,3-4,7-9,11-13,15-18H2,1-2H3/b23-14+ |
| InChIKey | KJYIQVIUXNEYRY-OEAKJJBVSA-N |
| XLogP | 6.69 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|