C25H27ClN2O4 — CID 23191510
2-benzyl-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]oxy-2-methyl-3-oxopropanoic acid (PubChem CID 23191510) has the molecular formula C25H27ClN2O4 and a molecular weight of 454.95 g/mol. Its IUPAC name is 2-benzyl-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]oxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-benzyl-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]oxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 23191510 |
| Molecular Formula | C25H27ClN2O4 |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-benzyl-3-[2-butyl-3-[(2-chlorophenyl)methyl]imidazol-4-yl]oxy-2-methyl-3-oxopropanoic acid |
| SMILES | CCCCc1ncc(OC(=O)C(C)(Cc2ccccc2)C(=O)O)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H27ClN2O4/c1-3-4-14-21-27-16-22(28(21)17-19-12-8-9-13-20(19)26)32-24(31)25(2,23(29)30)15-18-10-6-5-7-11-18/h5-13,16H,3-4,14-15,17H2,1-2H3,(H,29,30) |
| InChIKey | QAEKSHLATLRABV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|