C18H21ClN2O3 — CID 19936789
ethyl 4-[(2-butyl-5-formylimidazol-1-yl)methyl]-3-chlorobenzoate (PubChem CID 19936789) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is ethyl 4-[(2-butyl-5-formylimidazol-1-yl)methyl]-3-chlorobenzoate.
| Compound Name | ethyl 4-[(2-butyl-5-formylimidazol-1-yl)methyl]-3-chlorobenzoate |
|---|---|
| PubChem CID | 19936789 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | ethyl 4-[(2-butyl-5-formylimidazol-1-yl)methyl]-3-chlorobenzoate |
| SMILES | CCCCc1ncc(C=O)n1Cc1ccc(C(=O)OCC)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O3/c1-3-5-6-17-20-10-15(12-22)21(17)11-14-8-7-13(9-16(14)19)18(23)24-4-2/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | ZXQSDNWYIKNJJO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|