C10H7BrCl2O2 — CID 86646793
methyl (E)-3-(4-bromo-2,6-dichlorophenyl)prop-2-enoate (PubChem CID 86646793) has the molecular formula C10H7BrCl2O2 and a molecular weight of 309.97 g/mol. Its IUPAC name is methyl (E)-3-(4-bromo-2,6-dichlorophenyl)prop-2-enoate.
| Compound Name | methyl (E)-3-(4-bromo-2,6-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 86646793 |
| Molecular Formula | C10H7BrCl2O2 |
| Molecular Weight | 309.97 g/mol |
| Exact Mass | 307.90 |
| IUPAC Name | methyl (E)-3-(4-bromo-2,6-dichlorophenyl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H7BrCl2O2/c1-15-10(14)3-2-7-8(12)4-6(11)5-9(7)13/h2-5H,1H3/b3-2+ |
| InChIKey | WQKYNPVYJSESLM-NSCUHMNNSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.97 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|