C28H46O6SSi — CID 100966899
methyl (3E)-1-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclotridec-3-ene-1-carboxylate (PubChem CID 100966899) has the molecular formula C28H46O6SSi and a molecular weight of 538.82 g/mol. Its IUPAC name is methyl (3E)-1-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclotridec-3-ene-1-carboxylate.
| Compound Name | methyl (3E)-1-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclotridec-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 100966899 |
| Molecular Formula | C28H46O6SSi |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | methyl (3E)-1-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclotridec-3-ene-1-carboxylate |
| SMILES | COC(=O)C1(S(=O)(=O)c2ccccc2)CCCCCCCCC(O)/C=C(/CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C28H46O6SSi/c1-27(2,3)36(5,6)34-22-23-20-24(29)16-12-9-7-8-10-15-19-28(21-23,26(30)33-4)35(31,32)25-17-13-11-14-18-25/h11,13-14,17-18,20,24,29H,7-10,12,15-16,19,21-22H2,1-6H3/b23-20+ |
| InChIKey | VKFIFTDOVLIKDX-BSYVCWPDSA-N |
| XLogP | 6.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|