C30H44N2O4Si — CID 20823428
methyl 2-[[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-1-cyclohexyl-2-oxoethyl]amino]-2-phenylacetate (PubChem CID 20823428) has the molecular formula C30H44N2O4Si and a molecular weight of 524.78 g/mol. Its IUPAC name is methyl 2-[[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-1-cyclohexyl-2-oxoethyl]amino]-2-phenylacetate.
| Compound Name | methyl 2-[[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-1-cyclohexyl-2-oxoethyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 20823428 |
| Molecular Formula | C30H44N2O4Si |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | methyl 2-[[2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-1-cyclohexyl-2-oxoethyl]amino]-2-phenylacetate |
| SMILES | COC(=O)C(NC(C(=O)Nc1ccccc1CO[Si](C)(C)C(C)(C)C)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C30H44N2O4Si/c1-30(2,3)37(5,6)36-21-24-19-13-14-20-25(24)31-28(33)26(22-15-9-7-10-16-22)32-27(29(34)35-4)23-17-11-8-12-18-23/h8,11-14,17-20,22,26-27,32H,7,9-10,15-16,21H2,1-6H3,(H,31,33) |
| InChIKey | JEXSOYVCBIPKLW-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|