C26H38N2O4Si — CID 11259968
methyl (2S)-2-[[1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-1-oxobutan-2-yl]amino]-2-phenylacetate (PubChem CID 11259968) has the molecular formula C26H38N2O4Si and a molecular weight of 470.69 g/mol. Its IUPAC name is methyl (2S)-2-[[1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-1-oxobutan-2-yl]amino]-2-phenylacetate.
| Compound Name | methyl (2S)-2-[[1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-1-oxobutan-2-yl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 11259968 |
| Molecular Formula | C26H38N2O4Si |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | methyl (2S)-2-[[1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-1-oxobutan-2-yl]amino]-2-phenylacetate |
| SMILES | CCC(N[C@H](C(=O)OC)c1ccccc1)C(=O)Nc1ccccc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H38N2O4Si/c1-8-21(27-23(25(30)31-5)19-14-10-9-11-15-19)24(29)28-22-17-13-12-16-20(22)18-32-33(6,7)26(2,3)4/h9-17,21,23,27H,8,18H2,1-7H3,(H,28,29)/t21?,23-/m0/s1 |
| InChIKey | ROJHHBFUVAMGRR-YANBTOMASA-N |
| XLogP | 5.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|