C24H33NO4Si — CID 11796759
benzyl N-[2-[[(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]methyl]phenyl]carbamate (PubChem CID 11796759) has the molecular formula C24H33NO4Si and a molecular weight of 427.62 g/mol. Its IUPAC name is benzyl N-[2-[[(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]methyl]phenyl]carbamate.
| Compound Name | benzyl N-[2-[[(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 11796759 |
| Molecular Formula | C24H33NO4Si |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | benzyl N-[2-[[(2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H]1Cc1ccccc1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H33NO4Si/c1-24(2,3)30(4,5)28-17-22-21(29-22)15-19-13-9-10-14-20(19)25-23(26)27-16-18-11-7-6-8-12-18/h6-14,21-22H,15-17H2,1-5H3,(H,25,26)/t21-,22+/m0/s1 |
| InChIKey | PBCLQIPXOAQUGC-FCHUYYIVSA-N |
| XLogP | 5.77 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|