C20H30O7Si — CID 169299290
benzyl [(2R,3R,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-4-methyl-5-oxooxolan-3-yl] carbonate (PubChem CID 169299290) has the molecular formula C20H30O7Si and a molecular weight of 410.54 g/mol. Its IUPAC name is benzyl [(2R,3R,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-4-methyl-5-oxooxolan-3-yl] carbonate.
| Compound Name | benzyl [(2R,3R,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-4-methyl-5-oxooxolan-3-yl] carbonate |
|---|---|
| PubChem CID | 169299290 |
| Molecular Formula | C20H30O7Si |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | benzyl [(2R,3R,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-4-methyl-5-oxooxolan-3-yl] carbonate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(=O)[C@@](C)(O)[C@@H]1OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H30O7Si/c1-19(2,3)28(5,6)25-13-15-16(20(4,23)17(21)26-15)27-18(22)24-12-14-10-8-7-9-11-14/h7-11,15-16,23H,12-13H2,1-6H3/t15-,16-,20+/m1/s1 |
| InChIKey | FHIXGNBAUVPRGV-QINHECLXSA-N |
| XLogP | 3.41 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|