C18H29NO5Si — CID 167358439
(3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-methyl-4-(pyridin-4-ylmethoxy)oxolan-2-one (PubChem CID 167358439) has the molecular formula C18H29NO5Si and a molecular weight of 367.52 g/mol. Its IUPAC name is (3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-methyl-4-(pyridin-4-ylmethoxy)oxolan-2-one.
| Compound Name | (3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-methyl-4-(pyridin-4-ylmethoxy)oxolan-2-one |
|---|---|
| PubChem CID | 167358439 |
| Molecular Formula | C18H29NO5Si |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-methyl-4-(pyridin-4-ylmethoxy)oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(=O)[C@@](C)(O)[C@@H]1OCc1ccncc1 |
| InChI | InChI=1S/C18H29NO5Si/c1-17(2,3)25(5,6)23-12-14-15(18(4,21)16(20)24-14)22-11-13-7-9-19-10-8-13/h7-10,14-15,21H,11-12H2,1-6H3/t14-,15-,18+/m1/s1 |
| InChIKey | AEHNXMWRUQGTIA-RKVPGOIHSA-N |
| XLogP | 2.66 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|