C28H54O6Si3 — CID 177495281
(5S,8R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-prop-1-en-2-yl-9-trimethylsilyloxy-2-oxaspiro[4.5]decane-1,6-dione (PubChem CID 177495281) has the molecular formula C28H54O6Si3 and a molecular weight of 570.99 g/mol. Its IUPAC name is (5S,8R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-prop-1-en-2-yl-9-trimethylsilyloxy-2-oxaspiro[4.5]decane-1,6-dione.
| Compound Name | (5S,8R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-prop-1-en-2-yl-9-trimethylsilyloxy-2-oxaspiro[4.5]decane-1,6-dione |
|---|---|
| PubChem CID | 177495281 |
| Molecular Formula | C28H54O6Si3 |
| Molecular Weight | 570.99 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | (5S,8R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-prop-1-en-2-yl-9-trimethylsilyloxy-2-oxaspiro[4.5]decane-1,6-dione |
| SMILES | C=C(C)[C@H]1CC(=O)[C@@]2(CC1O[Si](C)(C)C)C(=O)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O6Si3/c1-19(2)20-16-23(29)28(17-21(20)33-35(9,10)11)24(34-37(14,15)27(6,7)8)22(32-25(28)30)18-31-36(12,13)26(3,4)5/h20-22,24H,1,16-18H2,2-15H3/t20-,21?,22?,24?,28-/m1/s1 |
| InChIKey | DUZNTDXBHYAHDP-LTVXZZLZSA-N |
| XLogP | 7.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.99 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|