C16H32O5Si2 — CID 10546484
(3R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyloxy-1,7-dioxaspiro[4.4]nonan-8-one (PubChem CID 10546484) has the molecular formula C16H32O5Si2 and a molecular weight of 360.60 g/mol. Its IUPAC name is (3R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyloxy-1,7-dioxaspiro[4.4]nonan-8-one.
| Compound Name | (3R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyloxy-1,7-dioxaspiro[4.4]nonan-8-one |
|---|---|
| PubChem CID | 10546484 |
| Molecular Formula | C16H32O5Si2 |
| Molecular Weight | 360.60 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (3R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyloxy-1,7-dioxaspiro[4.4]nonan-8-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)CO[C@@]12COC(=O)C2 |
| InChI | InChI=1S/C16H32O5Si2/c1-15(2,3)23(7,8)21-14-12(20-22(4,5)6)10-19-16(14)9-13(17)18-11-16/h12,14H,9-11H2,1-8H3/t12-,14+,16+/m1/s1 |
| InChIKey | GMSFBUYHNPOCFH-INWMFGNUSA-N |
| XLogP | 3.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|