C30H53NO6Si3 — CID 69241668
(4R,5S,6S,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-1-phenylmethoxy-5-trimethylsilyloxy-1-azaspiro[3.5]non-8-en-2-one (PubChem CID 69241668) has the molecular formula C30H53NO6Si3 and a molecular weight of 608.01 g/mol. Its IUPAC name is (4R,5S,6S,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-1-phenylmethoxy-5-trimethylsilyloxy-1-azaspiro[3.5]non-8-en-2-one.
| Compound Name | (4R,5S,6S,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-1-phenylmethoxy-5-trimethylsilyloxy-1-azaspiro[3.5]non-8-en-2-one |
|---|---|
| PubChem CID | 69241668 |
| Molecular Formula | C30H53NO6Si3 |
| Molecular Weight | 608.01 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | (4R,5S,6S,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-1-phenylmethoxy-5-trimethylsilyloxy-1-azaspiro[3.5]non-8-en-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@]2(C=C[C@@]1(O)O[Si](C)(C)C(C)(C)C)CC(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C30H53NO6Si3/c1-27(2,3)39(10,11)36-26-25(35-38(7,8)9)29(19-20-30(26,33)37-40(12,13)28(4,5)6)21-24(32)31(29)34-22-23-17-15-14-16-18-23/h14-20,25-26,33H,21-22H2,1-13H3/t25-,26+,29+,30-/m1/s1 |
| InChIKey | FLLBGFZXOZVMIH-MOXFVITDSA-N |
| XLogP | 6.98 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.01 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|