C16H30O3Si2 — CID 11267379
(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-(3-trimethylsilylprop-2-ynyl)oxolan-2-one (PubChem CID 11267379) has the molecular formula C16H30O3Si2 and a molecular weight of 326.59 g/mol. Its IUPAC name is (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-(3-trimethylsilylprop-2-ynyl)oxolan-2-one.
| Compound Name | (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-(3-trimethylsilylprop-2-ynyl)oxolan-2-one |
|---|---|
| PubChem CID | 11267379 |
| Molecular Formula | C16H30O3Si2 |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-(3-trimethylsilylprop-2-ynyl)oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1COC(=O)[C@H]1CC#C[Si](C)(C)C |
| InChI | InChI=1S/C16H30O3Si2/c1-16(2,3)21(7,8)19-14-12-18-15(17)13(14)10-9-11-20(4,5)6/h13-14H,10,12H2,1-8H3/t13-,14-/m0/s1 |
| InChIKey | JBUNCJPMCSSQPR-KBPBESRZSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|