C21H39NOSi3 — CID 10716280
(3S,4S)-1-[tert-butyl(dimethyl)silyl]-3,4-bis(3-trimethylsilylprop-2-ynyl)azetidin-2-one (PubChem CID 10716280) has the molecular formula C21H39NOSi3 and a molecular weight of 405.81 g/mol. Its IUPAC name is (3S,4S)-1-[tert-butyl(dimethyl)silyl]-3,4-bis(3-trimethylsilylprop-2-ynyl)azetidin-2-one.
| Compound Name | (3S,4S)-1-[tert-butyl(dimethyl)silyl]-3,4-bis(3-trimethylsilylprop-2-ynyl)azetidin-2-one |
|---|---|
| PubChem CID | 10716280 |
| Molecular Formula | C21H39NOSi3 |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (3S,4S)-1-[tert-butyl(dimethyl)silyl]-3,4-bis(3-trimethylsilylprop-2-ynyl)azetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)[C@@H](CC#C[Si](C)(C)C)[C@@H]1CC#C[Si](C)(C)C |
| InChI | InChI=1S/C21H39NOSi3/c1-21(2,3)26(10,11)22-19(15-13-17-25(7,8)9)18(20(22)23)14-12-16-24(4,5)6/h18-19H,14-15H2,1-11H3/t18-,19-/m0/s1 |
| InChIKey | NUMDQMQVOAJAQO-OALUTQOASA-N |
| XLogP | 5.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|